EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H57N11O11S2 |
| Net Charge | 0 |
| Average Mass | 944.107 |
| Monoisotopic Mass | 943.36804 |
| SMILES | CC=C(NC(=O)N[C@@H](Cc1ccccc1)C(=O)O)C(=O)N[C@@H](CO)C(=O)NC(=CC)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1c1nc(C(=O)N[C@@H](CCSC)C(=O)OC)cs1 |
| InChI | InChI=1S/C41H57N11O11S2/c1-5-24(45-34(56)29(21-53)48-33(55)25(6-2)50-41(62)51-28(38(59)60)20-23-12-8-7-9-13-23)32(54)46-26(14-10-17-44-40(42)43)37(58)52-18-11-15-31(52)36-49-30(22-65-36)35(57)47-27(16-19-64-4)39(61)63-3/h5-9,12-13,22,26-29,31,53H,10-11,14-21H2,1-4H3,(H,45,56)(H,46,54)(H,47,57)(H,48,55)(H,59,60)(H4,42,43,44)(H2,50,51,62)/t26-,27-,28-,29-,31-/m0/s1 |
| InChIKey | BCMYHBTYINFPDE-OLAIZJASSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chitinimonas koreensis DSM 17726 (ncbitaxon:1121278) | - | PubMed (34301933) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chitinimide A (CHEBI:223121) is a polypeptide (CHEBI:15841) |