EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO4P |
| Net Charge | +1 |
| Average Mass | 166.093 |
| Monoisotopic Mass | 166.02637 |
| SMILES | NC(CC[P+](=O)O)C(=O)O |
| InChI | InChI=1S/C4H8NO4P/c5-3(4(6)7)1-2-10(8)9/h3H,1-2,5H2,(H-,6,7,8,9)/p+1 |
| InChIKey | XEIKOOKVOJVKLG-UHFFFAOYSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (6678916) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MP-101 (CHEBI:223115) is a α-amino acid (CHEBI:33704) |