EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H37N3O5 |
| Net Charge | 0 |
| Average Mass | 483.609 |
| Monoisotopic Mass | 483.27332 |
| SMILES | CCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(=O)N[C@H](CO)Cc1ccccc1)[C@@H](C)CC |
| InChI | InChI=1S/C27H37N3O5/c1-4-18(3)25(27(35)28-21(17-31)15-19-9-7-6-8-10-19)30-26(34)23(29-24(33)5-2)16-20-11-13-22(32)14-12-20/h6-14,18,21,23,25,31-32H,4-5,15-17H2,1-3H3,(H,28,35)(H,29,33)(H,30,34)/t18-,21-,23-,25-/m0/s1 |
| InChIKey | LLNCQMGXHNBIJZ-RCGJGYDGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptacidiphilus rugosus (ncbitaxon:405783) | - | PubMed (30735389) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acidiphilamide D (CHEBI:223111) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S,3S)-2-[[(2S)-3-(4-hydroxyphenyl)-2-(propanoylamino)propanoyl]amino]-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-methylpentanamide |
| Manual Xrefs | Databases |
|---|---|
| 128444641 | ChemSpider |