EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H46N2O8 |
| Net Charge | 0 |
| Average Mass | 610.748 |
| Monoisotopic Mass | 610.32542 |
| SMILES | CC[C@H](C)C(=O)N[C@@H](C)C(=O)O[C@H]1C/C=C\C=C\C=C\[C@H](OC)CC(=O)NC2=CC(=O)C=C(CC/C=C(\C)[C@H](O)[C@@H]1C)C2=O |
| InChI | InChI=1S/C34H46N2O8/c1-7-21(2)33(41)35-24(5)34(42)44-29-17-12-10-8-9-11-16-27(43-6)20-30(38)36-28-19-26(37)18-25(32(28)40)15-13-14-22(3)31(39)23(29)4/h8-12,14,16,18-19,21,23-24,27,29,31,39H,7,13,15,17,20H2,1-6H3,(H,35,41)(H,36,38)/b9-8+,12-10-,16-11+,22-14+/t21-,23+,24-,27-,29-,31-/m0/s1 |
| InChIKey | JFTBOCROFWRVMA-YDTABVOZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces collinus (ncbitaxon:42684) | - | PubMed (6833138) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ansatrienin A2 (CHEBI:223094) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [(5R,6E,8E,10Z,13S,14S,15R,16E)-15-hydroxy-5-methoxy-14,16-dimethyl-3,22,24-trioxo-2-azabicyclo[18.3.1]tetracosa-1(23),6,8,10,16,20-hexaen-13-yl] (2S)-2-[[(2S)-2-methylbutanoyl]amino]propanoate |
| Manual Xrefs | Databases |
|---|---|
| 78443058 | ChemSpider |