EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H39N3O4 |
| Net Charge | 0 |
| Average Mass | 481.637 |
| Monoisotopic Mass | 481.29406 |
| SMILES | CCCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@H](CO)Cc1ccccc1)[C@@H](C)CC |
| InChI | InChI=1S/C28H39N3O4/c1-4-12-25(33)30-24(18-22-15-10-7-11-16-22)27(34)31-26(20(3)5-2)28(35)29-23(19-32)17-21-13-8-6-9-14-21/h6-11,13-16,20,23-24,26,32H,4-5,12,17-19H2,1-3H3,(H,29,35)(H,30,33)(H,31,34)/t20-,23-,24-,26-/m0/s1 |
| InChIKey | AMGKYMHWPUSUDA-VIRINCGLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptacidiphilus rugosus (ncbitaxon:405783) | - | PubMed (30735389) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acidiphilamide A (CHEBI:223093) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S,3S)-2-[[(2S)-2-(butanoylamino)-3-phenylpropanoyl]amino]-N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-methylpentanamide |