EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:223079 - 3-(7-hydroxy-9H-beta-carboline-1-yl)propanoic acid
| Formula | C14H12N2O3 |
| Net Charge | 0 |
| Average Mass | 256.261 |
| Monoisotopic Mass | 256.08479 |
| SMILES | O=C(O)CCc1nccc2c1nc1cc(=O)ccc12 |
| InChI | InChI=1S/C14H12N2O3/c17-8-1-2-9-10-5-6-15-11(3-4-13(18)19)14(10)16-12(9)7-8/h1-2,5-7,15-16H,3-4H2,(H,18,19) |
| InChIKey | MBOPWGSKAKJDIH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cortinarius brunneus (ncbitaxon:86082) | - | PubMed (17854153) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(7-hydroxy-9H-beta-carboline-1-yl)propanoic acid (CHEBI:223079) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 3-(7-oxo-2,9-dihydropyrido[3,4-b]indol-1-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9044178 | ChemSpider |