EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O2 |
| Net Charge | 0 |
| Average Mass | 286.415 |
| Monoisotopic Mass | 286.19328 |
| SMILES | C=C[C@@]1(C)C=C2CC[C@H]3C(CO)=CC(=O)C[C@]3(C)[C@H]2CC1 |
| InChI | InChI=1S/C19H26O2/c1-4-18(2)8-7-17-13(10-18)5-6-16-14(12-20)9-15(21)11-19(16,17)3/h4,9-10,16-17,20H,1,5-8,11-12H2,2-3H3/t16-,17-,18+,19-/m0/s1 |
| InChIKey | UAPFLEBLWXTKPA-OKYOBFRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomaduraspecies (ncbitaxon:1989) | - | PubMed (31481763) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| K4610422 (CHEBI:223077) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (4aR,4bS,7S,10aR)-7-ethenyl-1-(hydroxymethyl)-4a,7-dimethyl-4b,5,6,9,10,10a-hexahydro-4H-phenanthren-3-one |
| Manual Xrefs | Databases |
|---|---|
| 88297809 | ChemSpider |