EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O5 |
| Net Charge | 0 |
| Average Mass | 360.450 |
| Monoisotopic Mass | 360.19367 |
| SMILES | [H][C@@]12CC[C@]([H])(C(=O)CO)[C@@]1(C=O)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C21H28O5/c1-20-7-6-13(24)8-12(20)2-3-14-15-4-5-16(18(26)10-22)21(15,11-23)9-17(25)19(14)20/h8,11,14-17,19,22,25H,2-7,9-10H2,1H3/t14-,15-,16+,17-,19+,20-,21+/m0/s1 |
| InChIKey | PQSUYGKTWSAVDQ-ZVIOFETBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aldosterone (CHEBI:27584) has parent hydride pregnane (CHEBI:8386) |
| aldosterone (CHEBI:27584) has role human metabolite (CHEBI:77746) |
| aldosterone (CHEBI:27584) has role mouse metabolite (CHEBI:75771) |
| aldosterone (CHEBI:27584) is a 11β-hydroxy steroid (CHEBI:35346) |
| aldosterone (CHEBI:27584) is a 18-oxo steroid (CHEBI:36887) |
| aldosterone (CHEBI:27584) is a 20-oxo steroid (CHEBI:36885) |
| aldosterone (CHEBI:27584) is a 21-hydroxy steroid (CHEBI:35344) |
| aldosterone (CHEBI:27584) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| aldosterone (CHEBI:27584) is a C21-steroid hormone (CHEBI:64600) |
| aldosterone (CHEBI:27584) is a mineralocorticoid (CHEBI:25354) |
| aldosterone (CHEBI:27584) is a primary α-hydroxy ketone (CHEBI:139590) |
| aldosterone (CHEBI:27584) is a steroid aldehyde (CHEBI:131565) |
| Incoming Relation(s) |
| 5α-dihydroaldosterone (CHEBI:180475) has functional parent aldosterone (CHEBI:27584) |
| 5β-dihydroaldosterone (CHEBI:86389) has functional parent aldosterone (CHEBI:27584) |
| aldosterone hemiacetal (CHEBI:30834) has functional parent aldosterone (CHEBI:27584) |
| IUPAC Name |
|---|
| 11β,21-dihydroxy-3,20-dioxopregn-4-en-18-al |
| Synonyms | Source |
|---|---|
| 11beta,21-Dihydroxy-3,20-dioxo-4-pregnen-18-al | KEGG COMPOUND |
| (11β)-11,21-dihydroxy-3,20-dioxopregn-4-en-18-al | NIST Chemistry WebBook |
| (+)-aldosterone | NIST Chemistry WebBook |
| Aldosterone | KEGG COMPOUND |
| ALDOSTERONE | PDBeChem |
| UniProt Name | Source |
|---|---|
| aldosterone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 111 | DrugCentral |
| Aldosterone | Wikipedia |
| AS4 | PDBeChem |
| C01780 | KEGG COMPOUND |
| DB04630 | DrugBank |
| HMDB0000037 | HMDB |
| LMST02030026 | LIPID MAPS |
| LSM-42770 | LINCS |
| Citations |
|---|