EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25N3O9 |
| Net Charge | 0 |
| Average Mass | 427.410 |
| Monoisotopic Mass | 427.15908 |
| SMILES | CC(=O)N(O)CCC[C@H](NC(=O)[C@@H](NC(=O)c1cccc(O)c1O)[C@@H](C)O)C(=O)O |
| InChI | InChI=1S/C18H25N3O9/c1-9(22)14(20-16(26)11-5-3-7-13(24)15(11)25)17(27)19-12(18(28)29)6-4-8-21(30)10(2)23/h3,5,7,9,12,14,22,24-25,30H,4,6,8H2,1-2H3,(H,19,27)(H,20,26)(H,28,29)/t9-,12+,14+/m1/s1 |
| InChIKey | KCWDMHXDGAWLOA-LQJRIPTKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharopolyspora (ncbitaxon:1835) | - | PubMed (6874588) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vanoxonin (CHEBI:223023) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-5-[acetyl(hydroxy)amino]-2-[[(2S,3R)-2-[(2,3-dihydroxybenzoyl)amino]-3-hydroxybutanoyl]amino]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 143444 | ChemSpider |