EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H57N3O10 |
| Net Charge | 0 |
| Average Mass | 655.830 |
| Monoisotopic Mass | 655.40440 |
| SMILES | CC(C)C[C@@H]1C(=O)O[C@@H](C(C)C)C(=O)N(C)[C@H]([C@@H](C)O)C(=O)O[C@@H](C(C)C)C(=O)N(C)[C@H](C(C)C)C(=O)O[C@@H](C(C)C)C(=O)N1C |
| InChI | InChI=1S/C33H57N3O10/c1-16(2)15-22-31(41)44-26(19(7)8)30(40)36(14)24(21(11)37)33(43)46-27(20(9)10)29(39)35(13)23(17(3)4)32(42)45-25(18(5)6)28(38)34(22)12/h16-27,37H,15H2,1-14H3/t21-,22-,23-,24-,25+,26+,27+/m1/s1 |
| InChIKey | YBLZDYVXSUSQNF-ZUZUSLRPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium acuminatum (ncbitaxon:5515) | - | PubMed (19249325) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Enniatin P2 (CHEBI:223013) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3R,6S,9R,12S,15R,18S)-3-[(1R)-1-hydroxyethyl]-4,10,16-trimethyl-9-(2-methylpropyl)-6,12,15,18-tetra(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |