EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O4 |
| Net Charge | 0 |
| Average Mass | 306.402 |
| Monoisotopic Mass | 306.18311 |
| SMILES | CC1=C[C@@H](O)[C@H]2C[C@@H](C)C[C@@H](C)[C@@H]2[C@@]1(O)/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C18H26O4/c1-11-8-12(2)17-14(9-11)15(19)10-13(3)18(17,22)7-5-4-6-16(20)21/h4-7,10-12,14-15,17,19,22H,8-9H2,1-3H3,(H,20,21)/b6-4+,7-5+/t11-,12+,14+,15+,17-,18+/m0/s1 |
| InChIKey | UIZBWUKMTZMEGS-NJOIRKGMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (24605144) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tanzawaic acid I (CHEBI:222996) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-[(1S,4S,4aS,6S,8R,8aS)-1,4-dihydroxy-2,6,8-trimethyl-4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-yl]penta-2,4-dienoic acid |