EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H36O6 |
| Net Charge | 0 |
| Average Mass | 480.601 |
| Monoisotopic Mass | 480.25119 |
| SMILES | CCCCCC[C@H](C)/C=C(\C)C(=O)O[C@@]1(C)C(=O)c2c(cc(O)c3c(C)cccc23)[C@](C)(O)C1=O |
| InChI | InChI=1S/C29H36O6/c1-7-8-9-10-12-17(2)15-19(4)26(32)35-29(6)25(31)24-20-14-11-13-18(3)23(20)22(30)16-21(24)28(5,34)27(29)33/h11,13-17,30,34H,7-10,12H2,1-6H3/b19-15+/t17-,28-,29-/m0/s1 |
| InChIKey | HCFKALFLCWRAPK-SHUGVKLDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (30693772) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penijanthinone B (CHEBI:222975) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| [(1S,3S)-1,9-dihydroxy-1,3,8-trimethyl-2,4-dioxophenanthren-3-yl] (E,4S)-2,4-dimethyldec-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 71120874 | ChemSpider |