EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O4S |
| Net Charge | 0 |
| Average Mass | 272.326 |
| Monoisotopic Mass | 272.08308 |
| SMILES | C[C@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(SCCN)C[C@H]12 |
| InChI | InChI=1S/C11H16N2O4S/c1-5(14)8-6-4-7(18-3-2-12)9(11(16)17)13(6)10(8)15/h5-6,8,14H,2-4,12H2,1H3,(H,16,17)/t5-,6+,8+/m0/s1 |
| InChIKey | WKDDRNSBRWANNC-SHYZEUOFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptantibioticus cattleyicolor (ncbitaxon:29303) | - | PubMed (6630073) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-epi-thienamycin (CHEBI:222959) is a carbapenems (CHEBI:46633) |
| IUPAC Name |
|---|
| (5R,6S)-3-(2-aminoethylsulanyl)-6-[(1S)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 59702318 | ChemSpider |