EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23NO6S |
| Net Charge | 0 |
| Average Mass | 357.428 |
| Monoisotopic Mass | 357.12461 |
| SMILES | C/C=C/C=C/C(=O)SCC[C@H](NC(=O)C(O)/C=C/C(C)O)C(=O)O |
| InChI | InChI=1S/C16H23NO6S/c1-3-4-5-6-14(20)24-10-9-12(16(22)23)17-15(21)13(19)8-7-11(2)18/h3-8,11-13,18-19H,9-10H2,1-2H3,(H,17,21)(H,22,23)/b4-3+,6-5+,8-7+/t11?,12-,13?/m0/s1 |
| InChIKey | KSQNOKNLCAGGOM-IJAIYLEKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Punctularia strigosozonata (ncbitaxon:202698) | - | PubMed (29651464) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-[[(E)-2,5-dihydroxyhex-3-enoyl]amino]-4-[(2E,4E)-hexa-2,4-dienoyl]sulanylbutanoic acid (CHEBI:222907) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2S)-2-[[(E)-2,5-dihydroxyhex-3-enoyl]amino]-4-[(2E,4E)-hexa-2,4-dienoyl]sulanylbutanoic acid |