EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H10O7 |
| Net Charge | 0 |
| Average Mass | 326.260 |
| Monoisotopic Mass | 326.04265 |
| SMILES | COc1cc2oc(=O)c3c(C)cc(O)c4c(=O)c(=O)c(c1O)c2c34 |
| InChI | InChI=1S/C17H10O7/c1-5-3-6(18)10-12-9(5)17(22)24-7-4-8(23-2)14(19)13(11(7)12)16(21)15(10)20/h3-4,18-19H,1-2H3 |
| InChIKey | CCUJPSDKAUVKIU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cladonia macilenta (ncbitaxon:196765) | - | PubMed (23412057) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Biruloquinone (CHEBI:222881) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| 7,12-dihydroxy-13-methoxy-5-methyl-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-3,9,10-trione |
| Manual Xrefs | Databases |
|---|---|
| 4589978 | ChemSpider |