EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44N8O15 |
| Net Charge | 0 |
| Average Mass | 756.723 |
| Monoisotopic Mass | 756.29261 |
| SMILES | O=CN(O)CCC[C@@H](NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H]1COC(c2ccccc2O)=N1)C(=O)N[C@H](CCCNO)C(=O)O |
| InChI | InChI=1S/C30H44N8O15/c39-11-19(25(45)32-17(7-4-10-38(52)15-42)24(44)33-18(30(49)50)6-3-9-31-51)34-26(46)20(12-40)35-27(47)21(13-41)36-28(48)22-14-53-29(37-22)16-5-1-2-8-23(16)43/h1-2,5,8,15,17-22,31,39-41,43,51-52H,3-4,6-7,9-14H2,(H,32,45)(H,33,44)(H,34,46)(H,35,47)(H,36,48)(H,49,50)/t17-,18-,19+,20-,21+,22-/m1/s1 |
| InChIKey | BHWUAJFEXZMNJT-OVQJPPBNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Amycolatopsisspecies AA4 (ncbitaxon:1896961) | - | PubMed (21699219) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Amychelin B (CHEBI:222872) is a polypeptide (CHEBI:15841) |