EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N3O2S |
| Net Charge | 0 |
| Average Mass | 265.338 |
| Monoisotopic Mass | 265.08850 |
| SMILES | CCCSc1ccc2nc(NC(=O)OC)nc2c1 |
| InChI | InChI=1S/C12H15N3O2S/c1-3-6-18-8-4-5-9-10(7-8)14-11(13-9)15-12(16)17-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | HXHWSAZORRCQMX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. tubulin modulator Any substance that interacts with tubulin to inhibit or promote polymerisation of microtubules. antiviral agent A substance that destroys or inhibits replication of viruses. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. anthelminthic drug Substance intended to kill parasitic worms (helminths). gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| albendazole (CHEBI:16664) has role anthelminthic drug (CHEBI:35443) |
| albendazole (CHEBI:16664) has role anti-HIV agent (CHEBI:64946) |
| albendazole (CHEBI:16664) has role antiinfective agent (CHEBI:35441) |
| albendazole (CHEBI:16664) has role antimalarial (CHEBI:38068) |
| albendazole (CHEBI:16664) has role antiviral agent (CHEBI:22587) |
| albendazole (CHEBI:16664) has role gastrointestinal drug (CHEBI:55324) |
| albendazole (CHEBI:16664) has role microtubule-destabilising agent (CHEBI:61951) |
| albendazole (CHEBI:16664) has role tubulin modulator (CHEBI:60832) |
| albendazole (CHEBI:16664) is a aryl sulfide (CHEBI:35683) |
| albendazole (CHEBI:16664) is a benzimidazoles (CHEBI:22715) |
| albendazole (CHEBI:16664) is a benzimidazolylcarbamate fungicide (CHEBI:87064) |
| albendazole (CHEBI:16664) is a carbamate ester (CHEBI:23003) |
| Incoming Relation(s) |
| albendazole S-oxide (CHEBI:16959) has functional parent albendazole (CHEBI:16664) |
| hydroxyalbendazole (CHEBI:140182) has functional parent albendazole (CHEBI:16664) |
| IUPAC Name |
|---|
| methyl [5-(propylsulfanyl)-1H-benzimidazol-2-yl]carbamate |
| INN | Source |
|---|---|
| albendazol | WHO MedNet |
| Synonyms | Source |
|---|---|
| (5-(propylthio)-1H-benzimidazol-2-yl)carbamic acid methyl ester | ChemIDplus |
| 5-(propylthio)-2-carbomethoxyaminobenzimidazole | ChemIDplus |
| Albendazole | KEGG COMPOUND |
| Albendazolum | ChEMBL |
| Albenza | ChemIDplus |
| Andazol | ChEMBL |
| UniProt Name | Source |
|---|---|
| albendazole | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 103 | DrugCentral |
| 895 | VSDB |
| albendazole | Alan Wood's Pesticides |
| Albendazole | Wikipedia |
| ALBENDAZOLE | MetaCyc |
| C01779 | KEGG COMPOUND |
| D00134 | KEGG DRUG |
| DB00518 | DrugBank |
| HMDB0014659 | HMDB |
| LSM-3782 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:752696 | Reaxys |
| CAS:54965-21-8 | ChemIDplus |
| CAS:54965-21-8 | KEGG COMPOUND |
| Citations |
|---|