EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N3O2S |
| Net Charge | 0 |
| Average Mass | 265.338 |
| Monoisotopic Mass | 265.08850 |
| SMILES | CCCSc1ccc2nc(NC(=O)OC)nc2c1 |
| InChI | InChI=1S/C12H15N3O2S/c1-3-6-18-8-4-5-9-10(7-8)14-11(13-9)15-12(16)17-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | HXHWSAZORRCQMX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. tubulin modulator Any substance that interacts with tubulin to inhibit or promote polymerisation of microtubules. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| Applications: | anthelminthic drug Substance intended to kill parasitic worms (helminths). fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| albendazole (CHEBI:16664) has role anthelminthic drug (CHEBI:35443) |
| albendazole (CHEBI:16664) has role microtubule-destabilising agent (CHEBI:61951) |
| albendazole (CHEBI:16664) has role tubulin modulator (CHEBI:60832) |
| albendazole (CHEBI:16664) is a aryl sulfide (CHEBI:35683) |
| albendazole (CHEBI:16664) is a benzimidazoles (CHEBI:22715) |
| albendazole (CHEBI:16664) is a benzimidazolylcarbamate fungicide (CHEBI:87064) |
| albendazole (CHEBI:16664) is a carbamate ester (CHEBI:23003) |
| Incoming Relation(s) |
| albendazole S-oxide (CHEBI:16959) has functional parent albendazole (CHEBI:16664) |
| hydroxyalbendazole (CHEBI:140182) has functional parent albendazole (CHEBI:16664) |
| IUPAC Name |
|---|
| methyl [5-(propylsulfanyl)-1H-benzimidazol-2-yl]carbamate |
| Synonyms | Source |
|---|---|
| (5-(propylthio)-1H-benzimidazol-2-yl)carbamic acid methyl ester | ChemIDplus |
| 5-(propylthio)-2-carbomethoxyaminobenzimidazole | ChemIDplus |
| Albendazole | KEGG COMPOUND |
| Albenza | ChemIDplus |
| O-methyl N-(5-(propylthio)-2-benzimidazolyl)carbamate | ChemIDplus |
| Eskazole | ChemIDplus |
| UniProt Name | Source |
|---|---|
| albendazole | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 103 | DrugCentral |
| 895 | VSDB |
| albendazole | Alan Wood's Pesticides |
| Albendazole | Wikipedia |
| ALBENDAZOLE | MetaCyc |
| C01779 | KEGG COMPOUND |
| D00134 | KEGG DRUG |
| DB00518 | DrugBank |
| HMDB0014659 | HMDB |
| LSM-3782 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:752696 | Reaxys |
| CAS:54965-21-8 | ChemIDplus |
| CAS:54965-21-8 | KEGG COMPOUND |
| Citations |
|---|