EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N2O2 |
| Net Charge | 0 |
| Average Mass | 254.289 |
| Monoisotopic Mass | 254.10553 |
| SMILES | COC(=O)CCc1nccc2c1nc1ccccc12 |
| InChI | InChI=1S/C15H14N2O2/c1-19-14(18)7-6-13-15-11(8-9-16-13)10-4-2-3-5-12(10)17-15/h2-5,8-9,17H,6-7H2,1H3 |
| InChIKey | IYWBIIGDWQBZJQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cortinarius infractus (ncbitaxon:165398) | - | DOI (10.1016/s0040-4039(01)80250-1) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Infractin (CHEBI:222843) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| methyl 3-(9H-pyrido[3,4-b]indol-1-yl)propanoate |
| Manual Xrefs | Databases |
|---|---|
| 4477822 | ChemSpider |