EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H57NO11S |
| Net Charge | 0 |
| Average Mass | 663.871 |
| Monoisotopic Mass | 663.36523 |
| SMILES | CCC[C@H]1OC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CCSC)OC(=O)C[C@H](OC)[C@H](C)[C@H]2C[C@@H](OC)[C@@](C)(O)[C@@](O)(C[C@@H](O)[C@@H]1C)O2 |
| InChI | InChI=1S/C32H57NO11S/c1-10-11-23-19(4)22(34)17-32(39)31(6,38)27(41-8)15-26(44-32)20(5)25(40-7)16-28(35)42-24(12-13-45-9)29(36)33-21(14-18(2)3)30(37)43-23/h18-27,34,38-39H,10-17H2,1-9H3,(H,33,36)/t19-,20-,21+,22+,23+,24-,25-,26+,27+,31+,32+/m0/s1 |
| InChIKey | XFENGRLEXFEMMP-XQOJDCRESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Roseofilum reptotaenium (ncbitaxon:1233427) | - | PubMed (30636420) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Looekeyolide A (CHEBI:222842) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (1R,2S,3S,7S,10R,13R,14S,15R,17R,18R,19R)-15,17,18-trihydroxy-3,19-dimethoxy-2,14,18-trimethyl-10-(2-methylpropyl)-7-(2-methylsulanylethyl)-13-propyl-6,12,21-trioxa-9-azabicyclo[15.3.1]henicosane-5,8,11-trione |
| Manual Xrefs | Databases |
|---|---|
| 71115993 | ChemSpider |