EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N2O5 |
| Net Charge | 0 |
| Average Mass | 218.209 |
| Monoisotopic Mass | 218.09027 |
| SMILES | CC(=O)N[C@H]1NC[C@H](C(=O)O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H14N2O5/c1-3(11)10-7-6(13)5(12)4(2-9-7)8(14)15/h4-7,9,12-13H,2H2,1H3,(H,10,11)(H,14,15)/t4-,5-,6+,7+/m0/s1 |
| InChIKey | DQTKLICLJUKNCG-VWDOSNQTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (8609086) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| A-72363 A-1 (CHEBI:222804) is a carboxylic acid (CHEBI:33575) |
| A-72363 A-1 (CHEBI:222804) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| (3S,4S,5S,6R)-6-acetamido-4,5-dihydroxypiperidine-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 8551518 | ChemSpider |