EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N3O7 |
| Net Charge | 0 |
| Average Mass | 367.358 |
| Monoisotopic Mass | 367.13795 |
| SMILES | C[C@H](NC(=O)[C@@H](CO)NC(=O)c1ccccc1O)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C16H21N3O7/c1-9(14(24)17-7-6-13(22)23)18-16(26)11(8-20)19-15(25)10-4-2-3-5-12(10)21/h2-5,9,11,20-21H,6-8H2,1H3,(H,17,24)(H,18,26)(H,19,25)(H,22,23)/t9-,11+/m0/s1 |
| InChIKey | MDPPPHROPRGCAR-GXSJLCMTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomaduraspecies RB99 (ncbitaxon:2691577) | - | PubMed (35404539) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Madurastatin G1 (CHEBI:222796) is a peptide (CHEBI:16670) |