EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38N6O10 |
| Net Charge | 0 |
| Average Mass | 606.633 |
| Monoisotopic Mass | 606.26494 |
| SMILES | C[C@H](NC(=O)[C@@H](CO)NC(=O)c1ccccc1O)C(=O)NCCC(=O)N(O)CCCCC(=O)N(C)[C@H]1CC[C@H]2ON2C1=O |
| InChI | InChI=1S/C27H38N6O10/c1-16(29-26(40)18(15-34)30-25(39)17-7-3-4-8-20(17)35)24(38)28-13-12-22(37)32(42)14-6-5-9-21(36)31(2)19-10-11-23-33(43-23)27(19)41/h3-4,7-8,16,18-19,23,34-35,42H,5-6,9-15H2,1-2H3,(H,28,38)(H,29,40)(H,30,39)/t16-,18+,19-,23+,33?/m0/s1 |
| InChIKey | JTBPMKLRKJCVDY-GNSGKXHMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomaduraspecies RB99 (ncbitaxon:2691577) | - | PubMed (35404539) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Madurastatin F (CHEBI:222792) is a peptide (CHEBI:16670) |