EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26N6O4S2 |
| Net Charge | 0 |
| Average Mass | 538.655 |
| Monoisotopic Mass | 538.14570 |
| SMILES | CC1NC(=O)c2csc(n2)C(C)NC(=O)[C@H]2N=C(O[C@@H]2C)[C@H](Cc2ccccc2)NC(=O)c2csc1n2 |
| InChI | InChI=1S/C25H26N6O4S2/c1-12-24-30-18(11-37-24)21(33)28-16(9-15-7-5-4-6-8-15)23-31-19(14(3)35-23)22(34)27-13(2)25-29-17(10-36-25)20(32)26-12/h4-8,10-14,16,19H,9H2,1-3H3,(H,26,32)(H,27,34)(H,28,33)/t12?,13?,14-,16+,19+/m1/s1 |
| InChIKey | QCYRITGWCJOIEV-FFMCJANTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyanobacterium (ncbitaxon:102234) | - | DOI (10.1016/s0040-4020(02)01326-1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Banyascyclamide A (CHEBI:222788) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (4S,7R,8S)-4-benzyl-7,11,18-trimethyl-6-oxa-13,20-dithia-3,10,17,22,23,24-hexazatetracyclo[17.2.1.15,8.112,15]tetracosa-1(21),5(24),12(23),14,19(22)-pentaene-2,9,16-trione |
| Manual Xrefs | Databases |
|---|---|
| 78437708 | ChemSpider |