EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H41N7O10 |
| Net Charge | 0 |
| Average Mass | 635.675 |
| Monoisotopic Mass | 635.29149 |
| SMILES | C[C@H](NC(=O)[C@@H](CO)NC(=O)c1ccccc1O)C(=O)NCCC(=O)N(O)CCC[C@@H]1C(=O)N([C@H]2CCCN(O)C2=O)CN1C |
| InChI | InChI=1S/C28H41N7O10/c1-17(30-26(41)19(15-36)31-25(40)18-7-3-4-10-22(18)37)24(39)29-12-11-23(38)34(44)13-5-8-20-27(42)33(16-32(20)2)21-9-6-14-35(45)28(21)43/h3-4,7,10,17,19-21,36-37,44-45H,5-6,8-9,11-16H2,1-2H3,(H,29,39)(H,30,41)(H,31,40)/t17-,19+,20+,21-/m0/s1 |
| InChIKey | QYZHZWRQFNAGCS-KCLUMXDGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomaduraspecies RB99 (ncbitaxon:2691577) | - | PubMed (35404539) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Madurastatin E1 (CHEBI:222787) is a peptide (CHEBI:16670) |