EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32N3O7P |
| Net Charge | 0 |
| Average Mass | 493.497 |
| Monoisotopic Mass | 493.19779 |
| SMILES | CN[C@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NC(Cc1ccc(O)cc1)P(=O)(O)O)C(C)C |
| InChI | InChI=1S/C23H32N3O7P/c1-14(2)21(24-3)23(30)25-19(12-15-4-8-17(27)9-5-15)22(29)26-20(34(31,32)33)13-16-6-10-18(28)11-7-16/h4-11,14,19-21,24,27-28H,12-13H2,1-3H3,(H,25,30)(H,26,29)(H2,31,32,33)/t19-,20?,21-/m0/s1 |
| InChIKey | AFAFFSSNAUKMNO-YSTUSHMSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomadura (ncbitaxon:1988) | - | PubMed (6094415) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| I5B2 (CHEBI:222779) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| [2-(4-hydroxyphenyl)-1-[[(2S)-3-(4-hydroxyphenyl)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]propanoyl]amino]ethyl]phosphonic acid |
| Manual Xrefs | Databases |
|---|---|
| 111338 | ChemSpider |