EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H60N8O12 |
| Net Charge | 0 |
| Average Mass | 784.909 |
| Monoisotopic Mass | 784.43307 |
| SMILES | CC[C@H]1CC[C@](O)([C@](C)(O)C(=O)N[C@H](C(=O)N2NCCC[C@@H]2C(=O)N(O)[C@@H](C)C(=O)N2NCCC[C@@H]2C(=O)N2NCCC[C@H]2C(=O)O)[C@@H](O)C(C)C)O[C@@H]1C |
| InChI | InChI=1S/C35H60N8O12/c1-7-22-14-15-35(53,55-21(22)5)34(6,52)33(51)39-26(27(44)19(2)3)31(48)41-24(12-9-17-37-41)30(47)43(54)20(4)28(45)40-23(11-8-16-36-40)29(46)42-25(32(49)50)13-10-18-38-42/h19-27,36-38,44,52-54H,7-18H2,1-6H3,(H,39,51)(H,49,50)/t20-,21+,22-,23+,24+,25-,26-,27-,34+,35+/m0/s1 |
| InChIKey | JLHYWEMRFQKQBQ-KAKHCCBQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1016/j.tetlet.2022.153688) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dentigerumycin G (CHEBI:222767) is a peptide (CHEBI:16670) |