EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16ClNO6 |
| Net Charge | 0 |
| Average Mass | 341.747 |
| Monoisotopic Mass | 341.06661 |
| SMILES | C[C@@H]1O[C@@H](OC(=O)c2cnc3cc(Cl)ccc23)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H16ClNO6/c1-6-11(18)12(19)13(20)15(22-6)23-14(21)9-5-17-10-4-7(16)2-3-8(9)10/h2-6,11-13,15,17-20H,1H3/t6-,11+,12+,13+,15-/m0/s1 |
| InChIKey | BBKPPKNOPCGYQN-KPXRPKJJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kitasatosporaspecies MG372-hF19 (ncbitaxon:2605609) | - | PubMed (31735911) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-deoxy-alpha-L-talopyranose 1-(6-chloro-1H-indole-3-carboxylate) (CHEBI:222766) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| [(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 6-chloro-1H-indole-3-carboxylate |