EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H61N9O11 |
| Net Charge | 0 |
| Average Mass | 783.925 |
| Monoisotopic Mass | 783.44905 |
| SMILES | CC[C@H]1CC[C@](O)([C@](C)(O)C(=O)N[C@H](C(=O)N2NCCC[C@@H]2C(=O)N(O)[C@@H](C)C(=O)N2NCCC[C@@H]2C(=O)N2NCCC[C@H]2C(N)=O)[C@@H](O)C(C)C)O[C@@H]1C |
| InChI | InChI=1S/C35H61N9O11/c1-7-22-14-15-35(53,55-21(22)5)34(6,52)33(51)40-26(27(45)19(2)3)32(50)43-25(13-10-18-39-43)31(49)44(54)20(4)29(47)42-24(12-9-17-38-42)30(48)41-23(28(36)46)11-8-16-37-41/h19-27,37-39,45,52-54H,7-18H2,1-6H3,(H2,36,46)(H,40,51)/t20-,21+,22-,23-,24+,25+,26-,27-,34+,35+/m0/s1 |
| InChIKey | ZHHFUVLLFAFWSQ-PSLLLXPESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1016/j.tetlet.2022.153688) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dentigerumycin F (CHEBI:222763) is a peptide (CHEBI:16670) |