EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O3 |
| Net Charge | 0 |
| Average Mass | 272.344 |
| Monoisotopic Mass | 272.14124 |
| SMILES | CC(=O)/C(C)=C/[C@H](C)c1ccc(C)cc1/C=C/C(=O)O |
| InChI | InChI=1S/C17H20O3/c1-11-5-7-16(13(3)10-12(2)14(4)18)15(9-11)6-8-17(19)20/h5-10,13H,1-4H3,(H,19,20)/b8-6+,12-10+/t13-/m0/s1 |
| InChIKey | ANNOSVGZIYBENM-DRERGFJNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1039/d1qo01652k) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Veramycin G (CHEBI:222759) is a cinnamic acids (CHEBI:23252) |