EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23N5O9 |
| Net Charge | 0 |
| Average Mass | 465.419 |
| Monoisotopic Mass | 465.14958 |
| SMILES | N[C@H](C[C@H](O)c1ccccn1)C(=O)N[C@H](C(=O)O)[C@H]1O[C@@H](n2ccc(=O)nc2=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H23N5O9/c20-8(7-10(25)9-3-1-2-5-21-9)16(29)23-12(18(30)31)15-13(27)14(28)17(33-15)24-6-4-11(26)22-19(24)32/h1-6,8,10,12-15,17,25,27-28H,7,20H2,(H,23,29)(H,30,31)(H,22,26,32)/t8-,10+,12+,13-,14+,15-,17-/m1/s1 |
| InChIKey | QITMOLKAQFBQPD-DTMJTGTDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (3972731) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nikkomycin KZ (CHEBI:222713) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2R,4S)-2-amino-4-hydroxy-4-pyridin-2-ylbutanoyl]amino]-2-[(2R,3R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443035 | ChemSpider |