EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H35N3O7 |
| Net Charge | 0 |
| Average Mass | 453.536 |
| Monoisotopic Mass | 453.24750 |
| SMILES | CCC[C@@H](C)[C@@H](OC(=O)[C@H](NC(=O)[C@H](C)NC(=O)/C=C/C(N)=O)C(C)C)[C@H]1CCOC1=O |
| InChI | InChI=1S/C22H35N3O7/c1-6-7-13(4)19(15-10-11-31-21(15)29)32-22(30)18(12(2)3)25-20(28)14(5)24-17(27)9-8-16(23)26/h8-9,12-15,18-19H,6-7,10-11H2,1-5H3,(H2,23,26)(H,24,27)(H,25,28)/b9-8+/t13-,14+,15-,18-,19-/m1/s1 |
| InChIKey | KFOVZWSWKKYISY-IFXYZXERSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (22591554) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microtermolide B (CHEBI:222703) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| [(1R,2R)-2-methyl-1-[(3R)-2-oxooxolan-3-yl]pentyl] (2R)-2-[[(2S)-2-[[(E)-4-amino-4-oxobut-2-enoyl]amino]propanoyl]amino]-3-methylbutanoate |