EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O7 |
| Net Charge | 0 |
| Average Mass | 476.610 |
| Monoisotopic Mass | 476.27740 |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@@]2(C)C3=C(C(=O)C[C@]12C)[C@@](C)(CCC(=O)O)[C@H]1C[C@@H]3O[C@]1(C)CO |
| InChI | InChI=1S/C27H40O7/c1-15(6-7-20(30)31)16-8-11-25(3)23-18-12-19(27(5,14-28)34-18)24(2,10-9-21(32)33)22(23)17(29)13-26(16,25)4/h15-16,18-19,28H,6-14H2,1-5H3,(H,30,31)(H,32,33)/t15-,16-,18+,19-,24+,25+,26-,27-/m1/s1 |
| InChIKey | IABFUGDOHOVCEJ-MHSARYRJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma fornicatum (ncbitaxon:36071) | - | DOI (10.1016/j.tetlet.2004.02.056) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fornicatin A (CHEBI:222699) is a carbocyclic fatty acid (CHEBI:35744) |
| IUPAC Name |
|---|
| (4R)-4-[(1S,3R,6R,7R,11S,12R,13S)-11-(2-carboxyethyl)-13-(hydroxymethyl)-3,7,11,13-tetramethyl-9-oxo-14-oxatetracyclo[10.2.1.02,10.03,7]pentadec-2(10)-en-6-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9492489 | ChemSpider |