EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H51N5O6 |
| Net Charge | 0 |
| Average Mass | 589.778 |
| Monoisotopic Mass | 589.38393 |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)NC(C)(C)C(=O)N[C@@H](CC(C)C)C(=O)NC(C)(C)C(=O)N[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C31H51N5O6/c1-19(2)15-24(32-21(5)38)26(39)35-31(8,9)29(42)34-25(16-20(3)4)27(40)36-30(6,7)28(41)33-23(18-37)17-22-13-11-10-12-14-22/h10-14,19-20,23-25,37H,15-18H2,1-9H3,(H,32,38)(H,33,41)(H,34,42)(H,35,39)(H,36,40)/t23-,24+,25+/m1/s1 |
| InChIKey | KYTOQCVRVYQYDN-DSITVLBTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sepedonium (ncbitaxon:74837) | - | PubMed (9918401) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Peptaibolin (CHEBI:222686) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-acetamido-N-[1-[[(2S)-1-[[1-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]-4-methylpentanamide |