EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O5 |
| Net Charge | 0 |
| Average Mass | 312.321 |
| Monoisotopic Mass | 312.09977 |
| SMILES | COC1=C[C@]2(C)c3ccc4c(c3C(=O)[C@]2(O)CC1=O)CCC4=O |
| InChI | InChI=1S/C18H16O5/c1-17-8-14(23-2)13(20)7-18(17,22)16(21)15-10-4-6-12(19)9(10)3-5-11(15)17/h3,5,8,22H,4,6-7H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | WFIVBWNFWRLRET-QZTJIDSGSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asterogynin A (CHEBI:222685) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| (5bR,9aS)-9a-hydroxy-7-methoxy-5b-methyl-2,9-dihydro-1H-cyclopenta[a]luorene-3,8,10-trione |