EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H50N10O8 |
| Net Charge | 0 |
| Average Mass | 666.781 |
| Monoisotopic Mass | 666.38131 |
| SMILES | C/C=C(\NC(=O)[C@H]1CCCN1C(=O)[C@@H]1CCCCN1C(=O)[C@H](NC(=O)[C@@H](N)[C@@H](C)CCN=C(N)N)[C@H](C)N)C(=O)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C29H50N10O8/c1-4-17(23(41)36-18(14-40)28(46)47)35-24(42)19-9-7-13-38(19)26(44)20-8-5-6-12-39(20)27(45)22(16(3)30)37-25(43)21(31)15(2)10-11-34-29(32)33/h4,15-16,18-22,40H,5-14,30-31H2,1-3H3,(H,35,42)(H,36,41)(H,37,43)(H,46,47)(H4,32,33,34)/b17-4-/t15-,16-,18+,19+,20-,21-,22+/m0/s1 |
| InChIKey | ZLIFOKMGWXMKQW-RZQNIXAHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces lavendulae subsp. brasilicus (ncbitaxon:1522108) | - | PubMed (3839501) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lavendomycin (CHEBI:222643) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R)-2-[[(Z)-2-[[(2R)-1-[(2S)-1-[(2R,3S)-3-amino-2-[[(2S,3S)-2-amino-5-(diaminomethylideneamino)-3-methylpentanoyl]amino]butanoyl]piperidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]but-2-enoyl]amino]-3-hydroxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443026 | ChemSpider |