EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H66N6O7 |
| Net Charge | 0 |
| Average Mass | 743.003 |
| Monoisotopic Mass | 742.49930 |
| SMILES | CC(=O)CCCC[C@@H](C)C(=O)N(C)[C@H](C(=O)N(C)[C@H](C(=O)N[C@H](C(=O)N(C)[C@@H](C)C(=O)N(C)[C@@H](Cc1ccccc1)C(N)=O)C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C40H66N6O7/c1-24(2)32(39(52)43(10)29(9)38(51)44(11)31(35(41)48)23-30-21-15-14-16-22-30)42-36(49)33(25(3)4)45(12)40(53)34(26(5)6)46(13)37(50)27(7)19-17-18-20-28(8)47/h14-16,21-22,24-27,29,31-34H,17-20,23H2,1-13H3,(H2,41,48)(H,42,49)/t27-,29+,31+,32+,33+,34+/m1/s1 |
| InChIKey | WPASHCDGVMUZKC-GRPUOVBYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyanobacterium (ncbitaxon:102234) | - | PubMed (20441198) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Almiramide A (CHEBI:222641) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R)-N-[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-methylamino]-1-oxopropan-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-N,2-dimethyl-7-oxooctanamide |
| Manual Xrefs | Databases |
|---|---|
| 24671778 | ChemSpider |