EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16N2O4 |
| Net Charge | 0 |
| Average Mass | 312.325 |
| Monoisotopic Mass | 312.11101 |
| SMILES | Cc1cc(O)cc(=O)n1[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H16N2O4/c1-10-6-12(20)8-16(21)19(10)15(17(22)23)7-11-9-18-14-5-3-2-4-13(11)14/h2-6,8-9,15,18,20H,7H2,1H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | HWPPENPDZWUQTE-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (35045257) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Calipyridone C (CHEBI:222599) is a N-acyl-L-amino acid (CHEBI:21644) |