EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17NO4 |
| Net Charge | 0 |
| Average Mass | 299.326 |
| Monoisotopic Mass | 299.11576 |
| SMILES | COc1ccc([C@@]2(C(=O)O)c3ccccc3N[C@@H]2OC)cc1 |
| InChI | InChI=1S/C17H17NO4/c1-21-12-9-7-11(8-10-12)17(16(19)20)13-5-3-4-6-14(13)18-15(17)22-2/h3-10,15,18H,1-2H3,(H,19,20)/t15-,17-/m1/s1 |
| InChIKey | ONRNIIUHIVOZHT-NVXWUHKLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium raistrickii (ncbitaxon:69783) | - | DOI (10.1016/j.tet.2012.01.054) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Peneciraistin F (CHEBI:222583) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (2R,3R)-2-methoxy-3-(4-methoxyphenyl)-1,2-dihydroindole-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 29214570 | ChemSpider |