EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H37N7O11 |
| Net Charge | 0 |
| Average Mass | 575.576 |
| Monoisotopic Mass | 575.25511 |
| SMILES | CC(=O)N[C@@H](CCCN(O)C=O)C(=O)N[C@@H](CO)C(=O)N(O)CCC[C@@H]1NC(=O)[C@H](CCCN(O)C=O)NC1=O |
| InChI | InChI=1S/C22H37N7O11/c1-14(33)23-15(5-2-8-27(38)12-31)19(34)26-18(11-30)22(37)29(40)10-4-7-17-21(36)24-16(20(35)25-17)6-3-9-28(39)13-32/h12-13,15-18,30,38-40H,2-11H2,1H3,(H,23,33)(H,24,36)(H,25,35)(H,26,34)/t15-,16-,17-,18-/m0/s1 |
| InChIKey | IQMHGRIOYXVPSE-XSLAGTTESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (3005216) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Foroxymithine (CHEBI:222557) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-acetamido-5-[ormyl(hydroxy)amino]-N-[(2S)-1-[3-[(2S,5S)-5-[3-[ormyl(hydroxy)amino]propyl]-3,6-dioxopiperazin-2-yl]propyl-hydroxyamino]-3-hydroxy-1-oxopropan-2-yl]pentanamide |
| Manual Xrefs | Databases |
|---|---|
| 32814671 | ChemSpider |