EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H31N3O5 |
| Net Charge | 0 |
| Average Mass | 477.561 |
| Monoisotopic Mass | 477.22637 |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](C)NC(=O)[C@@H]1CCCN1C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C27H31N3O5/c1-19(25(32)29-22(27(34)35-2)18-21-12-7-4-8-13-21)28-26(33)23-14-9-17-30(23)24(31)16-15-20-10-5-3-6-11-20/h3-8,10-13,15-16,19,22-23H,9,14,17-18H2,1-2H3,(H,28,33)(H,29,32)/b16-15+/t19-,22+,23+/m1/s1 |
| InChIKey | CCNOTKXBNBKSMQ-AZXRIZJNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (31327868) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cipralphelin (CHEBI:222547) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| methyl (2S)-3-phenyl-2-[[(2R)-2-[[(2S)-1-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carbonyl]amino]propanoyl]amino]propanoate |
| Manual Xrefs | Databases |
|---|---|
| 81163316 | ChemSpider |