EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H56N6O8 |
| Net Charge | 0 |
| Average Mass | 808.977 |
| Monoisotopic Mass | 808.41596 |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](NC(=O)C(C)C)[C@@H](c2ccccc2)OC(=O)C[C@H](C)NC(=O)[C@@H](Cc2cnc3c(OC)cccc23)NC(=O)[C@H](Cc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C45H56N6O8/c1-8-27(4)37-45(57)51(6)34(23-29-16-11-9-12-17-29)43(55)48-33(24-31-25-46-38-32(31)20-15-21-35(38)58-7)42(54)47-28(5)22-36(52)59-40(30-18-13-10-14-19-30)39(44(56)49-37)50-41(53)26(2)3/h9-21,25-28,33-34,37,39-40,46H,8,22-24H2,1-7H3,(H,47,54)(H,48,55)(H,49,56)(H,50,53)/t27-,28-,33+,34-,37-,39-,40+/m0/s1 |
| InChIKey | LCKKQXQQDRNHBJ-CLAJVDMNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (35060699) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tasikamide G (CHEBI:222545) is a oligopeptide (CHEBI:25676) |