EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H54N6O11 |
| Net Charge | 0 |
| Average Mass | 854.958 |
| Monoisotopic Mass | 854.38506 |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](NC(=O)[C@@H](C)C(=O)O)[C@@H](c2ccccc2)OC(=O)C[C@H](C)NC(=O)[C@@H](Cc2cnc3c(OC)cccc23)NC(=O)[C@H]([C@@H](O)c2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C45H54N6O11/c1-7-24(2)34-44(58)51(5)37(38(53)27-15-10-8-11-16-27)43(57)48-31(22-29-23-46-35-30(29)19-14-20-32(35)61-6)41(55)47-25(3)21-33(52)62-39(28-17-12-9-13-18-28)36(42(56)49-34)50-40(54)26(4)45(59)60/h8-20,23-26,31,34,36-39,46,53H,7,21-22H2,1-6H3,(H,47,55)(H,48,57)(H,49,56)(H,50,54)(H,59,60)/t24-,25-,26+,31+,34-,36-,37-,38-,39+/m0/s1 |
| InChIKey | GYNSDVFIZHUJKD-FQGQXQHXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (35060699) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tasikamide F (CHEBI:222542) is a oligopeptide (CHEBI:25676) |