EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O6 |
| Net Charge | 0 |
| Average Mass | 352.342 |
| Monoisotopic Mass | 352.09469 |
| SMILES | O=C1C[C@@H](O)[C@H]2c3ccc(O)c4c3[C@@](O)(CCC4=O)c3ccc(O)c1c32 |
| InChI | InChI=1S/C20H16O6/c21-10-4-2-9-16-15(13(24)7-14(25)17(10)16)8-1-3-11(22)18-12(23)5-6-20(9,26)19(8)18/h1-4,13,15,21-22,24,26H,5-7H2/t13-,15-,20-/m1/s1 |
| InChIKey | GEKQQEKXERARED-WAWZGNHOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternariaspecies (ncbitaxon:1715220) | - | DOI (10.1021/jo00142a020) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Altertoxin I (CHEBI:222541) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (6bS,7R,12bR)-4,7,10,12b-tetrahydroxy-2,6b,7,8-tetrahydro-1H-perylene-3,9-dione |
| Manual Xrefs | Databases |
|---|---|
| 10196063 | ChemSpider |