EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H56N6O10 |
| Net Charge | 0 |
| Average Mass | 840.975 |
| Monoisotopic Mass | 840.40579 |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](NC(=O)[C@@H](C)CO)[C@@H](c2ccccc2)OC(=O)C[C@H](C)NC(=O)[C@@H](Cc2cnc3c(OC)cccc23)NC(=O)[C@H]([C@@H](O)c2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C45H56N6O10/c1-7-25(2)35-45(59)51(5)38(39(54)28-15-10-8-11-16-28)44(58)48-32(22-30-23-46-36-31(30)19-14-20-33(36)60-6)42(56)47-27(4)21-34(53)61-40(29-17-12-9-13-18-29)37(43(57)49-35)50-41(55)26(3)24-52/h8-20,23,25-27,32,35,37-40,46,52,54H,7,21-22,24H2,1-6H3,(H,47,56)(H,48,58)(H,49,57)(H,50,55)/t25-,26-,27-,32+,35-,37-,38-,39-,40+/m0/s1 |
| InChIKey | GHRZMPNIXJOCHB-ZDIUZWPHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (35060699) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tasikamide E (CHEBI:222536) is a oligopeptide (CHEBI:25676) |