EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H56N6O11 |
| Net Charge | 0 |
| Average Mass | 856.974 |
| Monoisotopic Mass | 856.40071 |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](NC(=O)C(C)(O)CO)[C@@H](c2ccccc2)OC(=O)C[C@H](C)NC(=O)[C@@H](Cc2cnc3c(OC)cccc23)NC(=O)[C@H]([C@@H](O)c2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C45H56N6O11/c1-7-25(2)34-43(58)51(5)37(38(54)27-15-10-8-11-16-27)42(57)48-31(22-29-23-46-35-30(29)19-14-20-32(35)61-6)40(55)47-26(3)21-33(53)62-39(28-17-12-9-13-18-28)36(41(56)49-34)50-44(59)45(4,60)24-52/h8-20,23,25-26,31,34,36-39,46,52,54,60H,7,21-22,24H2,1-6H3,(H,47,55)(H,48,57)(H,49,56)(H,50,59)/t25-,26-,31+,34-,36-,37-,38-,39+,45?/m0/s1 |
| InChIKey | UWCYKVJLEAKETK-SCLNSCSISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (35060699) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tasikamide D (CHEBI:222531) is a oligopeptide (CHEBI:25676) |