EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H41N5O6 |
| Net Charge | 0 |
| Average Mass | 603.720 |
| Monoisotopic Mass | 603.30568 |
| SMILES | CCCCC[C@@H]1NC(=O)[C@@H](NC(=O)Cc2ccccc2)[C@@H](C)OC(=O)CCNC(=O)[C@@H](Cc2cnc3ccccc23)NC1=O |
| InChI | InChI=1S/C33H41N5O6/c1-3-4-6-15-26-32(42)37-27(19-23-20-35-25-14-10-9-13-24(23)25)31(41)34-17-16-29(40)44-21(2)30(33(43)36-26)38-28(39)18-22-11-7-5-8-12-22/h5,7-14,20-21,26-27,30,35H,3-4,6,15-19H2,1-2H3,(H,34,41)(H,36,43)(H,37,42)(H,38,39)/t21-,26+,27-,30+/m1/s1 |
| InChIKey | HOELLZWBKZWCAI-DDCZRDCQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus (ncbitaxon:626) | - | PubMed (31263151) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xenematide G (CHEBI:222523) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| N-[(2R,3S,6S,9R)-9-(1H-indol-3-ylmethyl)-2-methyl-4,7,10,14-tetraoxo-6-pentyl-1-oxa-5,8,11-triazacyclotetradec-3-yl]-2-phenylacetamide |