EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H39N5O6 |
| Net Charge | 0 |
| Average Mass | 589.693 |
| Monoisotopic Mass | 589.29003 |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H](NC(=O)Cc2ccccc2)[C@@H](C)OC(=O)CCNC(=O)[C@@H](Cc2cnc3ccccc23)NC1=O |
| InChI | InChI=1S/C32H39N5O6/c1-19(2)15-25-31(41)35-26(17-22-18-34-24-12-8-7-11-23(22)24)30(40)33-14-13-28(39)43-20(3)29(32(42)36-25)37-27(38)16-21-9-5-4-6-10-21/h4-12,18-20,25-26,29,34H,13-17H2,1-3H3,(H,33,40)(H,35,41)(H,36,42)(H,37,38)/t20-,25+,26-,29+/m1/s1 |
| InChIKey | YCKMPIISCAOLAN-DPSAIFGTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus (ncbitaxon:626) | - | PubMed (31263151) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xenematide F (CHEBI:222515) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| N-[(2R,3S,6S,9R)-9-(1H-indol-3-ylmethyl)-2-methyl-6-(2-methylpropyl)-4,7,10,14-tetraoxo-1-oxa-5,8,11-triazacyclotetradec-3-yl]-2-phenylacetamide |