EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N3O5 |
| Net Charge | 0 |
| Average Mass | 387.436 |
| Monoisotopic Mass | 387.17942 |
| SMILES | CC(C)[C@@H]1C(=O)N[C@@H](C)[C@@]2(O)O[C@](C)(NC(=O)/C=C/c3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C20H25N3O5/c1-12(2)16-17(25)21-13(3)20(27)23(16)18(26)19(4,28-20)22-15(24)11-10-14-8-6-5-7-9-14/h5-13,16,27H,1-4H3,(H,21,25)(H,22,24)/b11-10+/t13-,16+,19-,20+/m0/s1 |
| InChIKey | MBRUSYMEKYVJSG-DMNONILESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus lentulus (ncbitaxon:293939) | - | PubMed (35302734) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lentopeptin B (CHEBI:222514) is a cyclic peptide (CHEBI:23449) |