EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H47N7O9 |
| Net Charge | 0 |
| Average Mass | 661.757 |
| Monoisotopic Mass | 661.34353 |
| SMILES | COCC(=O)N[C@@H](C(=O)N1NCCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)[C@H](C)C(=O)N[C@@H]1CCN(C(N)=O)C1=O)[C@H](O)C(C)C |
| InChI | InChI=1S/C31H47N7O9/c1-17(2)25(40)24(36-23(39)16-47-4)30(45)38-22(11-8-13-33-38)28(43)35-21(15-19-9-6-5-7-10-19)26(41)18(3)27(42)34-20-12-14-37(29(20)44)31(32)46/h5-7,9-10,17-18,20-22,24-26,33,40-41H,8,11-16H2,1-4H3,(H2,32,46)(H,34,42)(H,35,43)(H,36,39)/t18-,20+,21-,22-,24+,25+,26-/m0/s1 |
| InChIKey | IAYPOIKGUHHBAU-DNMAVYRHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies 07-234-A1I (ncbitaxon:1692109) | - | PubMed (26465675) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 25-epi-actinoramide A (CHEBI:222501) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (3S)-N-[(2S,3S,4S)-5-[[(3R)-1-carbamoyl-2-oxopyrrolidin-3-yl]amino]-3-hydroxy-4-methyl-5-oxo-1-phenylpentan-2-yl]-2-[(2R,3R)-3-hydroxy-2-[(2-methoxyacetyl)amino]-4-methylpentanoyl]diazinane-3-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 58925102 | ChemSpider |